EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O3 |
| Net Charge | 0 |
| Average Mass | 386.576 |
| Monoisotopic Mass | 386.28210 |
| SMILES | [H]C(=O)/C1=C/C[C@]2([H])[C@](C)(CC[C@]2([H])[C@@H](C)CCC=C(C)C)C[C@]2([H])[C@](C)(O)CC(=O)[C@]12[H] |
| InChI | InChI=1S/C25H38O3/c1-16(2)7-6-8-17(3)19-11-12-24(4)13-21-23(22(27)14-25(21,5)28)18(15-26)9-10-20(19)24/h7,9,15,17,19-21,23,28H,6,8,10-14H2,1-5H3/b18-9-/t17-,19+,20-,21-,23+,24+,25+/m0/s1 |
| InChIKey | PLWMYIADTRHIMY-BNFAVABNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ustus (ncbitaxon:40382) | - | PubMed (24287995) | |
| Mollisia sp. (ncbitaxon:1928189) | - | PubMed (15217290) | |
| Cochliobolus heterostrophus (ncbitaxon:5016) | - | PubMed (8735840) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. chemokine receptor 5 antagonist An antogonist that blocks chemokine receptor 5 (CCR5). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ophiobolin C (CHEBI:167548) has parent hydride ophiobolane (CHEBI:36552) |
| ophiobolin C (CHEBI:167548) has role Aspergillus metabolite (CHEBI:76956) |
| ophiobolin C (CHEBI:167548) has role antineoplastic agent (CHEBI:35610) |
| ophiobolin C (CHEBI:167548) has role apoptosis inducer (CHEBI:68495) |
| ophiobolin C (CHEBI:167548) has role chemokine receptor 5 antagonist (CHEBI:63673) |
| ophiobolin C (CHEBI:167548) has role fungal metabolite (CHEBI:76946) |
| ophiobolin C (CHEBI:167548) has role nematicide (CHEBI:25491) |
| ophiobolin C (CHEBI:167548) is a carbotricyclic compound (CHEBI:38032) |
| ophiobolin C (CHEBI:167548) is a cyclic ketone (CHEBI:3992) |
| ophiobolin C (CHEBI:167548) is a enal (CHEBI:51688) |
| ophiobolin C (CHEBI:167548) is a olefinic compound (CHEBI:78840) |
| ophiobolin C (CHEBI:167548) is a sesterterpenoid (CHEBI:26660) |
| ophiobolin C (CHEBI:167548) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (7E)-3-hydroxy-5-oxoophiobola-7,19-dien-25-al |
| Synonyms | Source |
|---|---|
| 3-hydroxy-5-oxo-ophiobola-7,19-dien-25-al | ChemIDplus |
| (1R,3S,4R,7S,8E,11S,12R)-4-hydroxy-1,4-dimethyl-12-[(2S)-6-methylhept-5-en-2-yl]-6-oxotricyclo[9.3.0.03,7]tetradec-8-ene-8-carbaldehyde | IUPAC |
| UniProt Name | Source |
|---|---|
| ophiobolin C | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:19022-51-6 | ChemIDplus |
| Citations |
|---|