EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O9 |
| Net Charge | 0 |
| Average Mass | 330.289 |
| Monoisotopic Mass | 330.09508 |
| SMILES | COc1cc(C(=O)O)ccc1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C14H18O9/c1-21-8-4-6(13(19)20)2-3-7(8)22-14-12(18)11(17)10(16)9(5-15)23-14/h2-4,9-12,14-18H,5H2,1H3,(H,19,20) |
| InChIKey | JYFOSWJYZIVJPO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gomphrena (ncbitaxon:169521) | leaf (BTO:0000713) | MetaboLights (MTBLS613) | Strain: Gomphrena agrestis Mart. |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vanillic acid glucoside (CHEBI:167540) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 57487549 | ChemSpider |