EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O10 |
| Net Charge | 0 |
| Average Mass | 360.315 |
| Monoisotopic Mass | 360.10565 |
| SMILES | COc1cc(C(=O)O)cc(OC)c1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C15H20O10/c1-22-7-3-6(14(20)21)4-8(23-2)13(7)25-15-12(19)11(18)10(17)9(5-16)24-15/h3-4,9-12,15-19H,5H2,1-2H3,(H,20,21) |
| InChIKey | BLKMDORKRDACEI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gomphrena (ncbitaxon:169521) | leaf (BTO:0000713) | MetaboLights (MTBLS613) | Strain: Gomphrena agrestis Mart. |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Syringic acid glucoside (CHEBI:167538) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 3,5-dimethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 57487561 | ChemSpider |