EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | [H][C@]12C[C@]3([H])[C@H](C(C)C)CC[C@@]3(C)CC1=C(C)[C@]1(C)CC[C@@]3([H])[C@H](C)CC[C@@]213 |
| InChI | InChI=1S/C25H40/c1-15(2)18-8-10-23(5)14-19-17(4)24(6)11-9-20-16(3)7-12-25(20,24)22(19)13-21(18)23/h15-16,18,20-22H,7-14H2,1-6H3/t16-,18+,20+,21-,22+,23+,24+,25-/m1/s1 |
| InChIKey | KZVSASHATZZHHJ-SBISLLLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus stellatus (ncbitaxon:1549217) | - | PubMed (27447198) | Strain: NBRC 32302 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quiannulatene (CHEBI:167518) has role Aspergillus metabolite (CHEBI:76956) |
| quiannulatene (CHEBI:167518) has role fungal metabolite (CHEBI:76946) |
| quiannulatene (CHEBI:167518) is a polycyclic olefin (CHEBI:35714) |
| quiannulatene (CHEBI:167518) is a sesterterpene (CHEBI:35192) |
| IUPAC Name |
|---|
| (3R,3aS,5aR,7aS,10S,10aR,11aS,11bR)-3,5a,6,7a-tetramethyl-10-(propan-2-yl)-2,3,3a,4,5,5a,7,7a,8,9,10,10a,11,11a-tetradecahydro-1H-pentaleno[6a,1-a]-s-indacene |
| Synonym | Source |
|---|---|
| (+)-quiannulatene | ChEBI |
| UniProt Name | Source |
|---|---|
| quiannulatene | UniProt |
| Citations |
|---|