EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16 |
| Net Charge | 0 |
| Average Mass | 100.205 |
| Monoisotopic Mass | 100.12520 |
| SMILES | CC[C@H](C)C(C)C |
| InChI | InChI=1S/C7H16/c1-5-7(4)6(2)3/h6-7H,5H2,1-4H3/t7-/m0/s1 |
| InChIKey | WGECXQBGLLYSFP-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-2,3-dimethylpentane (CHEBI:167516) is a 2,3-dimethylpentane (CHEBI:151115) |
| (3S)-2,3-dimethylpentane (CHEBI:167516) is enantiomer of (3R)-2,3-dimethylpentane (CHEBI:167515) |
| Incoming Relation(s) |
| (3R)-2,3-dimethylpentane (CHEBI:167515) is enantiomer of (3S)-2,3-dimethylpentane (CHEBI:167516) |
| IUPAC Name |
|---|
| (3S)-2,3-dimethylpentane |
| Synonyms | Source |
|---|---|
| (S)-(−)-2,3-dimethylpentane | ChEBI |
| (S)-2,3-dimethylpentane | NIST Chemistry WebBook |