EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | CNC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-6,9-11H,7H2,1H3/t9-/m0/s1 |
| InChIKey | ZCTYHONEGJTYQV-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| unidentified (ncbitaxon:32644) | soil (ENVO:00001998) | MetaboLights (MTBLS1196) | Strain: silty clay loam soil |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Halostachine (CHEBI:167510) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| (1R)-2-(methylamino)-1-phenylethanol |