EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CCC=C2/C=C(\C)C1=C(C)CC[C@H](O)C1 |
| InChI | InChI=1S/C28H46O/c1-19(2)9-7-10-21(4)26-14-15-27-23(11-8-16-28(26,27)6)17-22(5)25-18-24(29)13-12-20(25)3/h11,17,19,21,24,26-27,29H,7-10,12-16,18H2,1-6H3/b22-17+/t21-,24+,26-,27+,28-/m1/s1 |
| InChIKey | LSMNSOVKLBDZMU-DUVJLZCRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| unidentified (ncbitaxon:32644) | soil (ENVO:00001998) | MetaboLights (MTBLS1196) | Strain: silty clay loam soil |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methylprevitamin D (CHEBI:167507) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1S)-3-[(E)-1-[(1R,3aR,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl]prop-1-en-2-yl]-4-methylcyclohex-3-en-1-ol |
| Manual Xrefs | Databases |
|---|---|
| 4446861 | ChemSpider |
| LMST03020333 | LIPID MAPS |