EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | CC(C(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C6H10O4/c1-3(5(7)8)4(2)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10) |
| InChIKey | KLZYRCVPDWTZLH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| unidentified (ncbitaxon:32644) | soil (ENVO:00001998) | MetaboLights (MTBLS1196) | Strain: silty clay loam soil |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dimethylsuccinic acid (CHEBI:167506) has functional parent succinic acid (CHEBI:15741) |
| 2,3-dimethylsuccinic acid (CHEBI:167506) has role chelator (CHEBI:38161) |
| 2,3-dimethylsuccinic acid (CHEBI:167506) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| 2,3-dimethylsuccinic acid (CHEBI:167506) is conjugate acid of 2,3-dimethylsuccinate(2−) (CHEBI:191384) |
| Incoming Relation(s) |
| 2,3-dimethylsuccinate(2−) (CHEBI:191384) is conjugate base of 2,3-dimethylsuccinic acid (CHEBI:167506) |
| IUPAC Name |
|---|
| 2,3-dimethylbutanedioic acid |
| Synonyms | Source |
|---|---|
| α,β-dimethyl-succinic acid | ChEBI |
| α,β-dimethylsuccinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 11355 | ChemSpider |
| HMDB0245405 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723932 | Reaxys |
| CAS:13545-04-5 | ChemIDplus |
| CAS:13545-04-5 | NIST Chemistry WebBook |
| Citations |
|---|