EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O2 |
| Net Charge | 0 |
| Average Mass | 182.263 |
| Monoisotopic Mass | 182.13068 |
| SMILES | CC/C=C/CCC1CCCC(=O)O1 |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-7-10-8-6-9-11(12)13-10/h3-4,10H,2,5-9H2,1H3/b4-3+ |
| InChIKey | UJHDFCVFLRPEJQ-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-6-(3-hexenyl)tetrahydro-2H-pyran-2-one (CHEBI:167500) is a 6-(3-hexenyl)tetrahydro-2H-pyran-2-one (CHEBI:167501) |
| IUPAC Name |
|---|
| 6-[(3E)-hex-3-en-1-yl]tetrahydro-2H-pyran-2-one |
| Synonyms | Source |
|---|---|
| (3E)-6-(3-hexenyl)tetrahydro-2H-pyran-2-one | ChEBI |
| (3E)-6-(hex-3-en-1-yl)tetrahydro-2H-pyran-2-one | ChEBI |
| 6-[(3E)-hex-3-en-1-yl]oxan-2-one | IUPAC |
| 6-[(E)-hex-3-enyl]oxan-2-one | ChEBI |
| (8E)-5-hydroxy-8-undecenoic acid δ-lactone | ChEBI |
| (8E)-5-hydroxyundec-8-enoic acid δ-lactone | ChEBI |