EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12NO5 |
| Net Charge | -1 |
| Average Mass | 298.274 |
| Monoisotopic Mass | 298.07210 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)Nc1ccc(O)cc1C(=O)[O-] |
| InChI | InChI=1S/C16H13NO5/c18-11-4-1-10(2-5-11)3-8-15(20)17-14-7-6-12(19)9-13(14)16(21)22/h1-9,18-19H,(H,17,20)(H,21,22)/p-1/b8-3+ |
| InChIKey | QGUMNWHANDITDB-FPYGCLRLSA-M |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avenanthramide A(1−) (CHEBI:167464) is a anthranilate (CHEBI:16567) |
| avenanthramide A(1−) (CHEBI:167464) is conjugate base of Avenanthramide A (CHEBI:2939) |
| Incoming Relation(s) |
| Avenanthramide A (CHEBI:2939) is conjugate acid of avenanthramide A(1−) (CHEBI:167464) |
| UniProt Name | Source |
|---|---|
| avenanthramide A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-23404 | MetaCyc |
| Citations |
|---|