EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O4 |
| Net Charge | 0 |
| Average Mass | 130.099 |
| Monoisotopic Mass | 130.02661 |
| SMILES | COC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C5H6O4/c1-9-5(8)3-2-4(6)7/h2-3H,1H3,(H,6,7)/b3-2+ |
| InChIKey | NKHAVTQWNUWKEO-NSCUHMNNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Application: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monomethyl fumarate (CHEBI:167450) has functional parent fumaric acid (CHEBI:18012) |
| monomethyl fumarate (CHEBI:167450) has role antioxidant (CHEBI:22586) |
| monomethyl fumarate (CHEBI:167450) has role drug metabolite (CHEBI:49103) |
| monomethyl fumarate (CHEBI:167450) has role immunomodulator (CHEBI:50846) |
| monomethyl fumarate (CHEBI:167450) is a dicarboxylic acid monoester (CHEBI:36244) |
| monomethyl fumarate (CHEBI:167450) is a enoate ester (CHEBI:51702) |
| monomethyl fumarate (CHEBI:167450) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| (2E)-4-methoxy-4-oxobut-2-enoic acid |
| INNs | Source |
|---|---|
| fumarate de monométhyle | WHO MedNet |
| monomethyl fumarate | WHO MedNet |
| monomethylis fumaras | WHO MedNet |
| fumarato de monometilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| MMF | SUBMITTER |
| monomethylfumarate | SUBMITTER |
| (E)-4-methoxy-4-oxobut-2-enoic acid | ChEBI |
| methyl hydrogen fumarate | ChemIDplus |
| fumaric acid monomethyl ester | DrugBank |
| mono-methyl fumarate | ChEBI |
| Brand Name | Source |
|---|---|
| Bafiertam | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| FDB011972 | FooDB |
| DB14219 | DrugBank |
| HMDB0033809 | HMDB |
| D11492 | KEGG DRUG |
| Monomethyl_fumarate | Wikipedia |
| 4520322 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722673 | Reaxys |
| CAS:2756-87-8 | ChemIDplus |
| Citations |
|---|