EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:167419 - 2,4,5-Trimethoxybenzoic acid
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | COc1cc(OC)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C10H12O5/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12/h4-5H,1-3H3,(H,11,12) |
| InChIKey | KVZUCOGWKYOPID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,5-Trimethoxybenzoic acid (CHEBI:167419) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 2,4,5-trimethoxybenzoic acid |