EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:167381 - african-1-ene
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC[C@@H](C)C1=CC(C)(C)C[C@H]1C[C@]12C |
| InChI | InChI=1S/C15H24/c1-10-5-6-13-12(10)9-14(2,3)7-11-8-15(11,13)4/h9-11,13H,5-8H2,1-4H3/t10-,11+,13-,15-/m1/s1 |
| InChIKey | FCQGZOYPTSMOOM-NDPMZMCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinularia dissecta (WORMS:288514) | - | PubMed (12141876) | |
| Bazzania serrifolia (ncbitaxon:13807) | - | PubMed (29874780) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| african-1-ene (CHEBI:167381) has role animal metabolite (CHEBI:75767) |
| african-1-ene (CHEBI:167381) has role fungal metabolite (CHEBI:76946) |
| african-1-ene (CHEBI:167381) has role marine metabolite (CHEBI:76507) |
| african-1-ene (CHEBI:167381) has role plant metabolite (CHEBI:76924) |
| african-1-ene (CHEBI:167381) is a carbotricyclic compound (CHEBI:38032) |
| african-1-ene (CHEBI:167381) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1aR,5R,7aS,7bR)-3,3,5,7b-tetramethyl-1a,2,3,5,6,7,7a,7b-octahydro-1H-cyclopropa[e]azulene |
| Synonyms | Source |
|---|---|
| (1aR,5R,7aS,7bR)-3,3,5,7b-tetramethyl-1H,1aH,2H,3H,5H,6H,7H,7aH,7bH-cyclopropa[e]azulene | ChEBI |
| 1-africanene | ChEBI |
| UniProt Name | Source |
|---|---|
| african-1-ene | UniProt |
| Citations |
|---|