EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CC(C)(C)C/C(=C(/C)CO)[C@@]1([H])CC[C@@H]2C |
| InChI | InChI=1S/C15H26O/c1-10-5-6-12-13(10)7-15(3,4)8-14(12)11(2)9-16/h10,12-13,16H,5-9H2,1-4H3/b14-11+/t10-,12-,13-/m0/s1 |
| InChIKey | DJBXKQSFHIRXRM-JRYBIPSHSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichobrasilenol (CHEBI:167379) has role fungal metabolite (CHEBI:76946) |
| trichobrasilenol (CHEBI:167379) is a carbobicyclic compound (CHEBI:36785) |
| trichobrasilenol (CHEBI:167379) is a primary allylic alcohol (CHEBI:134394) |
| trichobrasilenol (CHEBI:167379) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (2E)-2-[(1S,3aS,7aS)-1,6,6-trimethyloctahydro-4H-inden-4-ylidene]propan-1-ol |
| Synonyms | Source |
|---|---|
| 2-[(1S,3aS,4E,7aS)-1,6,6-trimethyl-hexahydro-1H-inden-4-ylidene]propan-1-ol | ChEBI |
| 2-[(1S,3aS,4E,7aS)-1,6,6-trimethyl-octahydro-1H-inden-4-ylidene]propan-1-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| trichobrasilenol | UniProt |
| Citations |
|---|