EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O2 |
| Net Charge | 0 |
| Average Mass | 138.166 |
| Monoisotopic Mass | 138.06808 |
| SMILES | CC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C8H10O2/c1-5-4-8(6(2)9)7(3)10-5/h4H,1-3H3 |
| InChIKey | KBSVBCHYXYXDAG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (23845065) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-acetyl-2,5-dimethylfuran (CHEBI:167367) has role flavouring agent (CHEBI:35617) |
| 3-acetyl-2,5-dimethylfuran (CHEBI:167367) has role mutagen (CHEBI:25435) |
| 3-acetyl-2,5-dimethylfuran (CHEBI:167367) has role plant metabolite (CHEBI:76924) |
| 3-acetyl-2,5-dimethylfuran (CHEBI:167367) is a aromatic ketone (CHEBI:76224) |
| 3-acetyl-2,5-dimethylfuran (CHEBI:167367) is a furans (CHEBI:24129) |
| 3-acetyl-2,5-dimethylfuran (CHEBI:167367) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| 1-(2,5-dimethylfuran-3-yl)ethanone |
| Synonyms | Source |
|---|---|
| 1-(2,5-dimethyl-3-furanyl)ethanone | ChemIDplus |
| 1-(2,5-dimethyl-3-furyl)ethan-1-one | NIST Chemistry WebBook |
| 1-(2,5-dimethyl-3-furyl)ethanone | NIST Chemistry WebBook |
| 1-(2,5-dimethylfuran-3-yl)ethan-1-one | IUPAC |
| 2,5-dimethyl-3-acetylfuran | ChemIDplus |
| 2,5-dimethyl-3-furyl methyl ketone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 55447 | ChemSpider |
| FDB000718 | FooDB |
| HMDB0029563 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:112094 | Reaxys |
| CAS:10599-70-9 | ChemIDplus |
| CAS:10599-70-9 | NIST Chemistry WebBook |
| Citations |
|---|