EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@]12CC[C@]1(C)[C@@]1([H])CC(C)(C)[C@@]1([H])CC[C@]2(C)O |
| InChI | InChI=1S/C15H26O/c1-13(2)9-11-10(13)5-8-15(4,16)12-6-7-14(11,12)3/h10-12,16H,5-9H2,1-4H3/t10-,11-,12-,14+,15-/m0/s1 |
| InChIKey | CPLGPDHGFNXBOA-JVSQWTDWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus koraiensis (ncbitaxon:88728) | - | DOI (10.1007/BF00565927) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| koraiol (CHEBI:167323) has role plant metabolite (CHEBI:76924) |
| koraiol (CHEBI:167323) is a carbotricyclic compound (CHEBI:38032) |
| koraiol (CHEBI:167323) is a sesquiterpenoid (CHEBI:26658) |
| koraiol (CHEBI:167323) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,2R,5S,6S,9S)-2,6,10,10-tetramethyltricyclo[7.2.0.02,5]undecan-6-ol |
| Synonym | Source |
|---|---|
| korayol | ChEBI |
| UniProt Name | Source |
|---|---|
| koraiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| FDB016241 | FooDB |
| HMDB0037234 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:72188-51-3 | HMDB |
| Citations |
|---|