EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O |
| Net Charge | 0 |
| Average Mass | 228.295 |
| Monoisotopic Mass | 228.12626 |
| SMILES | CC(C)c1ncc(Cc2ccccc2)nc1=O |
| InChI | InChI=1S/C14H16N2O/c1-10(2)13-14(17)16-12(9-15-13)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,16,17) |
| InChIKey | CZUORGWXUVRUMV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus aureus (ncbitaxon:1280) | - | PubMed (23302043) | |
| Streptomyces sp. (ncbitaxon:1931) | - | DOI (10.7164/antibiotics.48.1165) | Strain: SC433 |
| Escherichia coli (ncbitaxon:562) | - | PubMed (28111075) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. calpain inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of any calpain. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phevalin (CHEBI:167320) has role bacterial metabolite (CHEBI:76969) |
| phevalin (CHEBI:167320) has role calpain inhibitor (CHEBI:82824) |
| phevalin (CHEBI:167320) is a benzenes (CHEBI:22712) |
| phevalin (CHEBI:167320) is a pyrazinone (CHEBI:167376) |
| IUPAC Name |
|---|
| 6-benzyl-3-(propan-2-yl)pyrazin-2(1H)-one |
| Synonyms | Source |
|---|---|
| aureusimine B | SUBMITTER |
| 6-benzyl-3-propan-2-yl-1H-pyrazin-2-one | ChEBI |
| 6-benzyl-3-isopropyl-1H-pyrazin-2-one | ChEBI |
| 6-benzyl-3-(propan-2-yl)-1,2-dihydropyrazin-2-one | ChEBI |
| 3-(1-methylethyl)-6-(phenylmethyl)-2(1H)-pyrazinone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00016595 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:170713-71-0 | SUBMITTER |
| Citations |
|---|