EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | CC(C)c1ccc(C(=O)O)c(O)c1O |
| InChI | InChI=1S/C10H12O4/c1-5(2)6-3-4-7(10(13)14)9(12)8(6)11/h3-5,11-12H,1-2H3,(H,13,14) |
| InChIKey | ZHDLAGPONFNQMZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxy-p-cumic acid (CHEBI:16725) has functional parent p-cumic acid (CHEBI:28122) |
| 2,3-dihydroxy-p-cumic acid (CHEBI:16725) is a dihydroxybenzoic acid (CHEBI:23778) |
| 2,3-dihydroxy-p-cumic acid (CHEBI:16725) is conjugate acid of 2,3-dihydroxy-p-cumate (CHEBI:36647) |
| Incoming Relation(s) |
| 2,3-dihydroxy-p-cumate (CHEBI:36647) is conjugate base of 2,3-dihydroxy-p-cumic acid (CHEBI:16725) |
| IUPAC Name |
|---|
| 2,3-dihydroxy-4-(propan-2-yl)benzoic acid |
| Synonyms | Source |
|---|---|
| 2,3-Dihydroxy-p-cumate | KEGG COMPOUND |
| 2,3-dihydroxy-4-(1-methylethyl)benzoic acid | ChEBI |
| 4-isopropyl-o-pyrocatechuic acid | ChEBI |
| 2,3-dihydroxy-4-isopropylbenzoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06580 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2722152 | Beilstein |
| CAS:19420-61-2 | UM-BBD |