EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9ClNO5PS |
| Net Charge | 0 |
| Average Mass | 297.656 |
| Monoisotopic Mass | 296.96276 |
| SMILES | COP(=S)(OC)Oc1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-6-3-4-8(10(11)12)7(9)5-6/h3-5H,1-2H3 |
| InChIKey | NZNRRXXETLSZRO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorthion (CHEBI:167184) has role agrochemical (CHEBI:33286) |
| chlorthion (CHEBI:167184) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| chlorthion (CHEBI:167184) is a C-nitro compound (CHEBI:35716) |
| chlorthion (CHEBI:167184) is a monochlorobenzenes (CHEBI:83403) |
| chlorthion (CHEBI:167184) is a organic thiophosphate (CHEBI:37512) |
| chlorthion (CHEBI:167184) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
| Synonyms | Source |
|---|---|
| chlortion | ChemIDplus |
| chlorothion | ChemIDplus |
| chlorthion methyl | ChemIDplus |
| methyl chlorothion | ChemIDplus |
| phosphorothioic acid O-(3-chloro-4-nitrophenyl) O,O-dimethyl ester | ChemIDplus |
| O,O-dimethyl O-(3-chloro-4-nitrophenyl) thionophosphate | ChEBI |
| Citations |
|---|