EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O4S |
| Net Charge | 0 |
| Average Mass | 216.258 |
| Monoisotopic Mass | 216.04563 |
| SMILES | CC(C)c1ccc(OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H12O4S/c1-7(2)8-3-5-9(6-4-8)13-14(10,11)12/h3-7H,1-2H3,(H,10,11,12) |
| InChIKey | ATVYHUAANHMUAO-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-isopropylphenyl sulfate (CHEBI:167180) has functional parent 4-isopropylphenol (CHEBI:167172) |
| 4-isopropylphenyl sulfate (CHEBI:167180) is a aryl sulfate (CHEBI:37919) |
| 4-isopropylphenyl sulfate (CHEBI:167180) is a benzenes (CHEBI:22712) |
| 4-isopropylphenyl sulfate (CHEBI:167180) is conjugate acid of 4-isopropylphenyl sulfate(1−) (CHEBI:167173) |
| Incoming Relation(s) |
| 4-isopropylphenyl sulfate(1−) (CHEBI:167173) is conjugate base of 4-isopropylphenyl sulfate (CHEBI:167180) |
| IUPAC Name |
|---|
| 4-(propan-2-yl)phenyl hydrogen sulfate |
| Synonym | Source |
|---|---|
| 4-isopropylphenyl hydrogen sulfate | ChEBI |