EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H44O2 |
| Net Charge | 0 |
| Average Mass | 376.625 |
| Monoisotopic Mass | 376.33413 |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)CC[C@H]1C(C)(C)CCC[C@]1(C)O |
| InChI | InChI=1S/C25H44O2/c1-20(11-8-13-22(3)16-19-26)10-7-12-21(2)14-15-23-24(4,5)17-9-18-25(23,6)27/h11-12,16,23,26-27H,7-10,13-15,17-19H2,1-6H3/b20-11+,21-12+,22-16+/t23-,25-/m0/s1 |
| InChIKey | QUPQWMJLAYCBOI-VHJBELJQSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| preluffariellolide A (CHEBI:167177) has role plant metabolite (CHEBI:76924) |
| preluffariellolide A (CHEBI:167177) is a diol (CHEBI:23824) |
| preluffariellolide A (CHEBI:167177) is a sesterterpenoid (CHEBI:26660) |
| IUPAC Name |
|---|
| (1S,2S)-2-[(3E,7E,11E)-13-hydroxy-3,7,11-trimethyltrideca-3,7,11-trien-1-yl]-1,3,3-trimethylcyclohexanol |
| Synonym | Source |
|---|---|
| (1S,2S)-2-[(3E,7E,11E)-13-hydroxy-3,7,11-trimethyltrideca-3,7,11-trien-1-yl]-1,3,3-trimethylcyclohexan-1-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| preluffariellolide A | UniProt |
| Citations |
|---|