EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O3 |
| Net Charge | 0 |
| Average Mass | 172.224 |
| Monoisotopic Mass | 172.10994 |
| SMILES | O=C(O)CC1(CO)CCCCC1 |
| InChI | InChI=1S/C9H16O3/c10-7-9(6-8(11)12)4-2-1-3-5-9/h10H,1-7H2,(H,11,12) |
| InChIKey | WMJPAYUKEVEBCN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexacyclonic acid (CHEBI:167168) has parent hydride cyclohexane (CHEBI:29005) |
| hexacyclonic acid (CHEBI:167168) has role central nervous system stimulant (CHEBI:35337) |
| hexacyclonic acid (CHEBI:167168) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| hexacyclonic acid (CHEBI:167168) is conjugate acid of hexacyclonate (CHEBI:167169) |
| Incoming Relation(s) |
| hexacyclonate (CHEBI:167169) is conjugate base of hexacyclonic acid (CHEBI:167168) |
| IUPAC Name |
|---|
| [1-(hydroxymethyl)cyclohexyl]acetic acid |
| Synonyms | Source |
|---|---|
| 1-(hydroxymethyl)cyclohexane-1-acetic acid | ChEBI |
| 1-(hydroxymethyl)-cyclohexaneacetic acid | ChemIDplus |
| 1-(hydroxymethyl)cyclohexaneacetic acid | ChEBI |
| 3,3-pentamethylene-4-hydoxybutyric acid | ChEBI |
| hexacyclonic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 21921 | ChemSpider |
| 3459 | DrugCentral |
| Hexacyclonate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:7491-42-1 | ChemIDplus |
| Citations |
|---|