EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO3 |
| Net Charge | 0 |
| Average Mass | 299.370 |
| Monoisotopic Mass | 299.15214 |
| SMILES | [H][C@@]12C=C[C@H](O)[C@@H]3Oc4c(OC)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C18H21NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3-6,11-13,17,20H,7-9H2,1-2H3/t11-,12+,13-,17-,18-/m0/s1 |
| InChIKey | OROGSEYTTFOCAN-DNJOTXNNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | opioid receptor agonist An agent that selectively binds to and activates an opioid receptor. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. drug allergen Any drug which causes the onset of an allergic reaction. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | opioid receptor agonist An agent that selectively binds to and activates an opioid receptor. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. drug allergen Any drug which causes the onset of an allergic reaction. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| codeine (CHEBI:16714) has functional parent morphine (CHEBI:17303) |
| codeine (CHEBI:16714) has role antitussive (CHEBI:51177) |
| codeine (CHEBI:16714) has role drug allergen (CHEBI:88188) |
| codeine (CHEBI:16714) has role environmental contaminant (CHEBI:78298) |
| codeine (CHEBI:16714) has role opioid analgesic (CHEBI:35482) |
| codeine (CHEBI:16714) has role opioid receptor agonist (CHEBI:60606) |
| codeine (CHEBI:16714) has role prodrug (CHEBI:50266) |
| codeine (CHEBI:16714) has role xenobiotic (CHEBI:35703) |
| codeine (CHEBI:16714) is a morphinane alkaloid (CHEBI:25418) |
| codeine (CHEBI:16714) is a organic heteropentacyclic compound (CHEBI:38164) |
| codeine (CHEBI:16714) is conjugate base of codeine(1+) (CHEBI:57871) |
| Incoming Relation(s) |
| dihydrocodeine phosphate (CHEBI:31489) has functional parent codeine (CHEBI:16714) |
| norcodeine (CHEBI:80579) has functional parent codeine (CHEBI:16714) |
| codeine(1+) (CHEBI:57871) is conjugate acid of codeine (CHEBI:16714) |
| IUPAC Name |
|---|
| 3-methoxy-17-methyl-7,8-didehydro-4,5α-epoxymorphinan-6α-ol |
| INNs | Source |
|---|---|
| codeína | ChEBI |
| codeine | ChEBI |
| codéine | ChEBI |
| Synonyms | Source |
|---|---|
| (1S,13R,14S,17R)-10-methoxy-4-methyl-12-oxa-4-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-ol | HMDB |
| (5alpha,6alpha)-7,8-Didehydro-4,5-epoxy-3-methoxy-17-methylmorphinan-6-ol | KEGG COMPOUND |
| 7,8-didehydro-4,5α-epoxy-3-methoxy-17-methylmorphinan-6α-ol | NIST Chemistry WebBook |
| Codein | ChEBI |
| (−)-Codeine | HMDB |
| Codeine | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Codicept | DrugBank |
| Coducept | DrugBank |
| Citations |
|---|