EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56O10 |
| Net Charge | 0 |
| Average Mass | 648.834 |
| Monoisotopic Mass | 648.38735 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@H](O)C[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(C)C=O |
| InChI | InChI=1S/C36H56O10/c1-31(2)13-14-36(30(44)46-29-28(43)27(42)26(41)21(17-37)45-29)20(15-31)19-7-8-23-32(3)11-10-24(39)33(4,18-38)22(32)9-12-34(23,5)35(19,6)16-25(36)40/h7,18,20-29,37,39-43H,8-17H2,1-6H3/t20-,21+,22+,23+,24-,25+,26+,27-,28+,29-,32-,33-,34+,35+,36+/m0/s1 |
| InChIKey | ZVZVUYATPFOSIP-GTECIAEHSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quillaic acid 28-β-D-glucoside (CHEBI:167137) has functional parent quillaic acid (CHEBI:8710) |
| quillaic acid 28-β-D-glucoside (CHEBI:167137) has role plant metabolite (CHEBI:76924) |
| quillaic acid 28-β-D-glucoside (CHEBI:167137) is a monosaccharide derivative (CHEBI:63367) |
| quillaic acid 28-β-D-glucoside (CHEBI:167137) is a triterpenoid saponin (CHEBI:61778) |
| quillaic acid 28-β-D-glucoside (CHEBI:167137) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1-O-(3β,16α-dihydroxy-23,28-dioxoolean-12-en-28-yl)-β-D-glucopyranose |
| UniProt Name | Source |
|---|---|
| quillaic acid 28-β-D-glucoside | UniProt |
| Citations |
|---|