EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H45O5 |
| Net Charge | -1 |
| Average Mass | 485.685 |
| Monoisotopic Mass | 485.32725 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)[O-])[C@H](O)C[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(C)C=O |
| InChI | InChI=1S/C30H46O5/c1-25(2)13-14-30(24(34)35)19(15-25)18-7-8-21-26(3)11-10-22(32)27(4,17-31)20(26)9-12-28(21,5)29(18,6)16-23(30)33/h7,17,19-23,32-33H,8-16H2,1-6H3,(H,34,35)/p-1/t19-,20+,21+,22-,23+,26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | MQUFAARYGOUYEV-UAWZMHPWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quillate (CHEBI:167136) is a monocarboxylic acid anion (CHEBI:35757) |
| quillate (CHEBI:167136) is conjugate base of quillaic acid (CHEBI:8710) |
| Incoming Relation(s) |
| quillaic acid (CHEBI:8710) is conjugate acid of quillate (CHEBI:167136) |
| IUPAC Name |
|---|
| 3β,16α-dihydroxy-23-oxoolean-12-en-28-oate |
| Synonym | Source |
|---|---|
| quillaic acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| quillate | UniProt |
| Citations |
|---|