EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O6S |
| Net Charge | 0 |
| Average Mass | 170.142 |
| Monoisotopic Mass | 169.98851 |
| SMILES | O=C(O)[C@H](O)CS(=O)(=O)O |
| InChI | InChI=1S/C3H6O6S/c4-2(3(5)6)1-10(7,8)9/h2,4H,1H2,(H,5,6)(H,7,8,9)/t2-/m1/s1 |
| InChIKey | CQQGIWJSICOUON-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-sulfolactic acid (CHEBI:16712) is a 3-sulfolactic acid (CHEBI:38023) |
| (S)-3-sulfolactic acid (CHEBI:16712) is conjugate acid of (S)-3-sulfonatolactate(2−) (CHEBI:61289) |
| (S)-3-sulfolactic acid (CHEBI:16712) is enantiomer of (R)-3-sulfolactic acid (CHEBI:48291) |
| Incoming Relation(s) |
| (S)-3-sulfonatolactate(2−) (CHEBI:61289) is conjugate base of (S)-3-sulfolactic acid (CHEBI:16712) |
| (R)-3-sulfolactic acid (CHEBI:48291) is enantiomer of (S)-3-sulfolactic acid (CHEBI:16712) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3-sulfopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C11499 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2441637 | Beilstein |