EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39N5O12S |
| Net Charge | 0 |
| Average Mass | 645.688 |
| Monoisotopic Mass | 645.23159 |
| SMILES | CC[C@@]1(C)Oc2cc(c(S(=O)C[C@@H](O)C[C@H](N)C(=O)O)cc2O)[C@@H](O)[C@H](NC)C(=O)N[C@@H](C)C(=O)N[C@@H]1C(=O)NCC(=O)O |
| InChI | InChI=1S/C26H39N5O12S/c1-5-26(3)21(24(39)29-9-18(34)35)31-22(37)11(2)30-23(38)19(28-4)20(36)13-7-16(43-26)15(33)8-17(13)44(42)10-12(32)6-14(27)25(40)41/h7-8,11-12,14,19-21,28,32-33,36H,5-6,9-10,27H2,1-4H3,(H,29,39)(H,30,38)(H,31,37)(H,34,35)(H,40,41)/t11-,12-,14-,19-,20+,21+,26+,44?/m0/s1 |
| InChIKey | BISPUFPESHDUKH-CEALTDAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ustilaginoidea virens (ncbitaxon:1159556) | - | PubMed (8071121) | Isolated from the false smut balls caused by Ustilaginoidea virens on rice. |
| Aspergillus flavus (ncbitaxon:5059) | - | PubMed (24841822) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ustiloxin B (CHEBI:167111) has role Aspergillus metabolite (CHEBI:76956) |
| ustiloxin B (CHEBI:167111) has role microtubule-destabilising agent (CHEBI:61951) |
| ustiloxin B (CHEBI:167111) has role mycotoxin (CHEBI:25442) |
| ustiloxin B (CHEBI:167111) is a aromatic ether (CHEBI:35618) |
| ustiloxin B (CHEBI:167111) is a heterodetic cyclic peptide (CHEBI:24533) |
| ustiloxin B (CHEBI:167111) is a macrocycle (CHEBI:51026) |
| ustiloxin B (CHEBI:167111) is a phenols (CHEBI:33853) |
| ustiloxin B (CHEBI:167111) is a secondary alcohol (CHEBI:35681) |
| ustiloxin B (CHEBI:167111) is a secondary carboxamide (CHEBI:140325) |
| ustiloxin B (CHEBI:167111) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| (4S)-5-{[(3R,4S,7S,10S,11R)-4-[(carboxymethyl)carbamoyl]-3-ethyl-11,15-dihydroxy-3,7-dimethyl-10-(methylamino)-6,9-dioxo-2-oxa-5,8-diazabicyclo[10.3.1]hexadeca-1(16),12,14-trien-13-yl]sulfinyl}-4-hydroxy-L-norvaline |
| Manual Xrefs | Databases |
|---|---|
| FDB021299 | FooDB |
| C00016647 | KNApSAcK |
| HMDB0041373 | HMDB |
| 8093149 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:151841-41-7 | ChemIDplus |
| Citations |
|---|