EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O11P2 |
| Net Charge | 0 |
| Average Mass | 310.088 |
| Monoisotopic Mass | 309.98548 |
| SMILES | O=C(COP(=O)(O)O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H12O11P2/c6-3(1-15-17(9,10)11)5(8)4(7)2-16-18(12,13)14/h3,5-6,8H,1-2H2,(H2,9,10,11)(H2,12,13,14)/t3-,5-/m1/s1 |
| InChIKey | YAHZABJORDUQGO-NQXXGFSBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | DOI (10.1074/jbc.274.1.397) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-ribulose 1,5-bisphosphate (CHEBI:16710) has functional parent D-ribulose (CHEBI:17173) |
| D-ribulose 1,5-bisphosphate (CHEBI:16710) has role Escherichia coli metabolite (CHEBI:76971) |
| D-ribulose 1,5-bisphosphate (CHEBI:16710) has role plant metabolite (CHEBI:76924) |
| D-ribulose 1,5-bisphosphate (CHEBI:16710) is a ribulose phosphate (CHEBI:26573) |
| D-ribulose 1,5-bisphosphate (CHEBI:16710) is conjugate acid of D-ribulose 1,5-bisphosphate(4−) (CHEBI:57870) |
| Incoming Relation(s) |
| D-ribulose 1,5-bisphosphate(4−) (CHEBI:57870) is conjugate base of D-ribulose 1,5-bisphosphate (CHEBI:16710) |
| IUPAC Names |
|---|
| D-ribulose 1,5-bis(dihydrogen phosphate) |
| 1,5-di-O-phosphono-D-ribulose |
| D-erythro-pentulose 1,5-bis(dihydrogen phosphate) |
| 1,5-di-O-phosphono-D-erythro-pent-2-ulose |
| Synonyms | Source |
|---|---|
| D-Ribulose 1,5-bisphosphate | KEGG COMPOUND |
| RIBULOSE-1,5-DIPHOSPHATE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C01182 | KEGG COMPOUND |
| D-RIBULOSE-15-P2 | MetaCyc |
| Ribulose-1,5-bisphosphate | Wikipedia |
| C00007293 | KNApSAcK |
| RUB | PDBeChem |
| ECMDB20145 | ECMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2299163 | Reaxys |
| CAS:24218-00-6 | KEGG COMPOUND |
| Citations |
|---|