EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NOS |
| Net Charge | 0 |
| Average Mass | 151.190 |
| Monoisotopic Mass | 151.00918 |
| SMILES | O=c1nsc2ccccc12 |
| InChI | InChI=1S/C7H5NOS/c9-7-5-3-1-2-4-6(5)10-8-7/h1-4H,(H,8,9) |
| InChIKey | DMSMPAJRVJJAGA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. drug allergen Any drug which causes the onset of an allergic reaction. disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzo[d]isothiazol-3-one (CHEBI:167099) has role disinfectant (CHEBI:48219) |
| benzo[d]isothiazol-3-one (CHEBI:167099) has role drug allergen (CHEBI:88188) |
| benzo[d]isothiazol-3-one (CHEBI:167099) has role environmental contaminant (CHEBI:78298) |
| benzo[d]isothiazol-3-one (CHEBI:167099) has role platelet aggregation inhibitor (CHEBI:50427) |
| benzo[d]isothiazol-3-one (CHEBI:167099) has role sensitiser (CHEBI:139492) |
| benzo[d]isothiazol-3-one (CHEBI:167099) has role xenobiotic (CHEBI:35703) |
| benzo[d]isothiazol-3-one (CHEBI:167099) is a organic heterobicyclic compound (CHEBI:27171) |
| benzo[d]isothiazol-3-one (CHEBI:167099) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| 1,2-benzisothiazol-3(2H)-one |
| Synonyms | Source |
|---|---|
| 1,2-Benzisothiazol-3(2H)-one | ChemIDplus |
| 1,2-Benzisothiazolin-3-one | ChEBI |
| 1,2-Benzisothiazoline-3-one | ChemIDplus |
| 2,3-dihydro-3-oxo-1,2-benzisothiazole | ChEBI |
| benzisothiazolone | ChEBI |
| BIT | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1361 | PPDB |
| Benzisothiazolinone | Wikipedia |
| HMDB0034413 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:119510 | Reaxys |
| CAS:2634-33-5 | ChemIDplus |
| Citations |
|---|