EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:167083 - 3-phenylfuran
| Formula | C10H8O |
| Net Charge | 0 |
| Average Mass | 144.173 |
| Monoisotopic Mass | 144.05751 |
| SMILES | c1ccc(-c2ccoc2)cc1 |
| InChI | InChI=1S/C10H8O/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8H |
| InChIKey | BNANPEQZOWHZKY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tuber magnatum (ncbitaxon:42249) | fruit body (BTO:0000487) | MetaboLights (MTBLS808) | Strain: Tuber magnatum Pico |
| Roles Classification |
|---|
| Chemical Role: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phenylfuran (CHEBI:167083) has role flavouring agent (CHEBI:35617) |
| 3-phenylfuran (CHEBI:167083) has role fungal metabolite (CHEBI:76946) |
| 3-phenylfuran (CHEBI:167083) has role Maillard reaction product (CHEBI:77523) |
| 3-phenylfuran (CHEBI:167083) is a benzenes (CHEBI:22712) |
| 3-phenylfuran (CHEBI:167083) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 3-phenylfuran |
| Synonym | Source |
|---|---|
| 3-phenyl-furan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 452592 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13679-41-9 | NIST Chemistry WebBook |
| Citations |
|---|