EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N6O9S |
| Net Charge | 0 |
| Average Mass | 630.680 |
| Monoisotopic Mass | 630.21080 |
| SMILES | COc1c(-c2coc(-c3ccccc3N)n2)nc2c(=O)n([C@@H](CO)C(=O)NC[C@@H](O)C(=O)N[C@H](CO)CC(C)C)sc2c1O |
| InChI | InChI=1S/C28H34N6O9S/c1-13(2)8-14(10-35)31-26(40)19(37)9-30-25(39)18(11-36)34-28(41)21-24(44-34)22(38)23(42-3)20(33-21)17-12-43-27(32-17)15-6-4-5-7-16(15)29/h4-7,12-14,18-19,35-37H,8-11,29H2,1-3H3,(H,30,39)(H,31,40)(H,33,38)/t14-,18-,19+/m0/s1 |
| InChIKey | DZVHAUSOBYTBDX-ZOCIIQOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. RKND-216 (ncbitaxon:2562581) | - | PubMed (32363877) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levesquamide (CHEBI:167048) has role antitubercular agent (CHEBI:33231) |
| levesquamide (CHEBI:167048) has role bacterial metabolite (CHEBI:76969) |
| levesquamide (CHEBI:167048) is a 1,3-oxazoles (CHEBI:46812) |
| levesquamide (CHEBI:167048) is a anilines (CHEBI:22562) |
| levesquamide (CHEBI:167048) is a aromatic ether (CHEBI:35618) |
| levesquamide (CHEBI:167048) is a polyketide (CHEBI:26188) |
| levesquamide (CHEBI:167048) is a primary alcohol (CHEBI:15734) |
| levesquamide (CHEBI:167048) is a secondary alcohol (CHEBI:35681) |
| levesquamide (CHEBI:167048) is a secondary carboxamide (CHEBI:140325) |
| levesquamide (CHEBI:167048) is a thiazolopyridine (CHEBI:46956) |
| IUPAC Name |
|---|
| (2S)-2-{5-[2-(2-aminophenyl)-1,3-oxazol-4-yl]-7-hydroxy-6-methoxy-3-oxo[1,2]thiazolo[4,5-b]pyridin-2(3H)-yl}-3-hydroxy-N-[(2R)-2-hydroxy-3-{[(2S)-1-hydroxy-4-methylpentan-2-yl]amino}-3-oxopropyl]propanamide |
| Citations |
|---|