EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15N3O3 |
| Net Charge | 0 |
| Average Mass | 309.325 |
| Monoisotopic Mass | 309.11134 |
| SMILES | Nc1ccccc1C(=O)NC1CC(=O)c2ccccc2NC1=O |
| InChI | InChI=1S/C17H15N3O3/c18-12-7-3-1-5-10(12)16(22)20-14-9-15(21)11-6-2-4-8-13(11)19-17(14)23/h1-8,14H,9,18H2,(H,19,23)(H,20,22) |
| InChIKey | TVPLZAQWRYWFFT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus ATCC 20542 (ncbitaxon:285217) | - | PubMed (32843555) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terreazepine (CHEBI:167044) has functional parent anthranilic acid (CHEBI:30754) |
| terreazepine (CHEBI:167044) has role Aspergillus metabolite (CHEBI:76956) |
| terreazepine (CHEBI:167044) is a anilines (CHEBI:22562) |
| terreazepine (CHEBI:167044) is a benzamides (CHEBI:22702) |
| terreazepine (CHEBI:167044) is a benzazepine (CHEBI:35676) |
| terreazepine (CHEBI:167044) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-amino-N-(2,5-dioxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)benzamide |
| Synonym | Source |
|---|---|
| 2-amino-N-(2,5-dioxo-3,4-dihydro-1H-1-benzazepin-3-yl)benzamide | ChEBI |
| Citations |
|---|