EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H28N2O3 |
| Net Charge | 0 |
| Average Mass | 452.554 |
| Monoisotopic Mass | 452.20999 |
| SMILES | COc1c(CC=C(C)C)c(-c2cnc3ccccc23)c(OC)c(O)c1-c1cnc2ccccc12 |
| InChI | InChI=1S/C29H28N2O3/c1-17(2)13-14-20-25(21-15-30-23-11-7-5-9-18(21)23)29(34-4)27(32)26(28(20)33-3)22-16-31-24-12-8-6-10-19(22)24/h5-13,15-16,30-32H,14H2,1-4H3 |
| InChIKey | YVQFFNCNPFQQKW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | - | PubMed (8064296) | Strain: NRRL 3519 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochrindole A (CHEBI:167043) has role Aspergillus metabolite (CHEBI:76956) |
| ochrindole A (CHEBI:167043) has role antibacterial agent (CHEBI:33282) |
| ochrindole A (CHEBI:167043) has role insecticide (CHEBI:24852) |
| ochrindole A (CHEBI:167043) is a bisindole alkaloid (CHEBI:51879) |
| ochrindole A (CHEBI:167043) is a dimethoxybenzene (CHEBI:51681) |
| ochrindole A (CHEBI:167043) is a indoles (CHEBI:24828) |
| ochrindole A (CHEBI:167043) is a olefinic compound (CHEBI:78840) |
| ochrindole A (CHEBI:167043) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,5-di(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-en-1-yl)phenol |
| Synonym | Source |
|---|---|
| 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:157414-83-0 | ChEBI |
| Citations |
|---|