EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H28N2O3 |
| Net Charge | 0 |
| Average Mass | 452.554 |
| Monoisotopic Mass | 452.20999 |
| SMILES | COc1c(CC=C(C)C)c(-c2cnc3ccccc23)c(OC)c(O)c1-c1cnc2ccccc12 |
| InChI | InChI=1S/C29H28N2O3/c1-17(2)13-14-20-25(21-15-30-23-11-7-5-9-18(21)23)29(34-4)27(32)26(28(20)33-3)22-16-31-24-12-8-6-10-19(22)24/h5-13,15-16,30-32H,14H2,1-4H3 |
| InChIKey | YVQFFNCNPFQQKW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | - | PubMed (8064296) | Strain: NRRL 3519 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochrindole A (CHEBI:167043) has role Aspergillus metabolite (CHEBI:76956) |
| ochrindole A (CHEBI:167043) has role antibacterial agent (CHEBI:33282) |
| ochrindole A (CHEBI:167043) has role insecticide (CHEBI:24852) |
| ochrindole A (CHEBI:167043) is a bisindole alkaloid (CHEBI:51879) |
| ochrindole A (CHEBI:167043) is a dimethoxybenzene (CHEBI:51681) |
| ochrindole A (CHEBI:167043) is a indoles (CHEBI:24828) |
| ochrindole A (CHEBI:167043) is a olefinic compound (CHEBI:78840) |
| ochrindole A (CHEBI:167043) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,5-di(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-en-1-yl)phenol |
| Synonym | Source |
|---|---|
| 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:157414-83-0 | ChEBI |
| Citations |
|---|