EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27O9P |
| Net Charge | 0 |
| Average Mass | 430.390 |
| Monoisotopic Mass | 430.13927 |
| SMILES | C[C@@](O)(/C=C/[C@H]1CC=CC(=O)O1)[C@@H](C[C@@H](O)/C=C\C=C/C=C/CO)OP(=O)(O)O |
| InChI | InChI=1S/C19H27O9P/c1-19(23,12-11-16-9-7-10-18(22)27-16)17(28-29(24,25)26)14-15(21)8-5-3-2-4-6-13-20/h2-8,10-12,15-17,20-21,23H,9,13-14H2,1H3,(H2,24,25,26)/b3-2-,6-4+,8-5-,12-11+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | ZMQRJWIYMXZORG-DSWNLJKISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces pulveraceus (ncbitaxon:68258) | - | PubMed (23352138) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor Any EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of phosphoprotein phosphatase (EC 3.1.3.16). topoisomerase II inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase II. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fostriecin (CHEBI:167004) has role antineoplastic agent (CHEBI:35610) |
| fostriecin (CHEBI:167004) has role apoptosis inhibitor (CHEBI:68494) |
| fostriecin (CHEBI:167004) has role bacterial metabolite (CHEBI:76969) |
| fostriecin (CHEBI:167004) has role EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor (CHEBI:37153) |
| fostriecin (CHEBI:167004) has role topoisomerase II inhibitor (CHEBI:156203) |
| fostriecin (CHEBI:167004) is a 2-pyranones (CHEBI:75885) |
| fostriecin (CHEBI:167004) is a olefinic compound (CHEBI:78840) |
| fostriecin (CHEBI:167004) is a phosphate monoester (CHEBI:7794) |
| fostriecin (CHEBI:167004) is a polyketide (CHEBI:26188) |
| fostriecin (CHEBI:167004) is a primary allylic alcohol (CHEBI:134394) |
| fostriecin (CHEBI:167004) is a secondary allylic alcohol (CHEBI:134396) |
| fostriecin (CHEBI:167004) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1E,3R,4R,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyl-1-[(2R)-6-oxo-3,6-dihydro-2H-pyran-2-yl]trideca-1,7,9,11-tetraen-4-yl dihydrogen phosphate |
| INNs | Source |
|---|---|
| fostriecin | WHO MedNet |
| fostriecina | WHO MedNet |
| fostriécine | WHO MedNet |
| fostriecinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (6R)-5,6-dihydro-6-[(1E,3R,4R,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyl-4-(phosphonooxy)-1,7,9,11-tridecatetraenyl]-2H-pyran-2-one | ChEBI |
| antibiotic CI 920 | ChemIDplus |
| antibiotic CL 1565A | ChemIDplus |
| CI 920 | ChemIDplus |
| CI-920 | ChemIDplus |
| CL 1565A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4510160 | ChemSpider |
| C00018551 | KNApSAcK |
| Fostriecin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:87810-56-8 | ChemIDplus |
| Citations |
|---|