EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO2 |
| Net Charge | 0 |
| Average Mass | 163.176 |
| Monoisotopic Mass | 163.06333 |
| SMILES | O=C(O)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C9H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-4,8,10H,5H2,(H,11,12) |
| InChIKey | QNRXNRGSOJZINA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indoline-2-carboxylic acid (CHEBI:167001) is a indoles (CHEBI:24828) |
| indoline-2-carboxylic acid (CHEBI:167001) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2,3-dihydro-1H-indole-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CA2488324 | Patent |
| WO2006053440 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:78348-24-0 | ChemIDplus |