EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46NO2 |
| Net Charge | +1 |
| Average Mass | 416.670 |
| Monoisotopic Mass | 416.35231 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])C[C@]3([H])O[C@@]5(CC[C@H](C)C[NH2+]5)[C@@H](C)[C@]43[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C27H45NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h16-24,28-29H,5-15H2,1-4H3/p+1/t16-,17-,18-,19-,20+,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | XYNPYHXGMWJBLV-VXPJTDKGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tomatidine(1+) (CHEBI:166999) is a secondary ammonium ion (CHEBI:137419) |
| tomatidine(1+) (CHEBI:166999) is conjugate acid of tomatidine (CHEBI:9629) |
| Incoming Relation(s) |
| tomatidine (CHEBI:9629) is conjugate base of tomatidine(1+) (CHEBI:166999) |
| UniProt Name | Source |
|---|---|
| tomatidine | UniProt |
| Citations |
|---|