EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21F2N3O |
| Net Charge | 0 |
| Average Mass | 333.382 |
| Monoisotopic Mass | 333.16527 |
| SMILES | C[C@@H]1CC(C)(C)c2cccc(NC(=O)c3cn(C)nc3C(F)F)c21 |
| InChI | InChI=1S/C18H21F2N3O/c1-10-8-18(2,3)12-6-5-7-13(14(10)12)21-17(24)11-9-23(4)22-15(11)16(19)20/h5-7,9-10,16H,8H2,1-4H3,(H,21,24)/t10-/m1/s1 |
| InChIKey | YTCIYOXHHQLDEI-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of succinate dehydrogenase (quinone), EC 1.3.5.1. |
| Applications: | fungicide A substance used to destroy fungal pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inpyrfluxam (CHEBI:166908) has role EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor (CHEBI:83072) |
| inpyrfluxam (CHEBI:166908) has role fungicide (CHEBI:24127) |
| inpyrfluxam (CHEBI:166908) is a indanes (CHEBI:46940) |
| inpyrfluxam (CHEBI:166908) is a organofluorine pesticide (CHEBI:38805) |
| inpyrfluxam (CHEBI:166908) is a pyrazoles (CHEBI:26410) |
| inpyrfluxam (CHEBI:166908) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 3-(difluoromethyl)-1-methyl-N-[(3R)-1,1,3-trimethyl-2,3-dihydro-1H-inden-4-yl]-1H-pyrazole-4-carboxamide |
| Synonyms | Source |
|---|---|
| 3-(difluoromethyl)-N-[(3R)-2,3-dihydro-1,1,3-trimethyl-1H-inden-4-yl]-1-methyl-1H-pyrazole-4-carboxamide | Alan Wood's Pesticides |
| 3-(difluoromethyl)-N-[(R)-2,3-dihydro-1,1,3-trimethyl-1H-inden-4-yl]-1-methyl-1H-pyrazole-4-carboxamide | Alan Wood's Pesticides |
| 3-(difluoromethyl)-N-[(R)-2,3-dihydro-1,1,3-trimethyl-1H-inden-4-yl]-1-methylpyrazole-4-carboxamide | ChEBI |
| inpyrfluxame | ChEBI |
| Brand Name | Source |
|---|---|
| Indiflin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 59403484 | ChemSpider |
| inpyrfluxam | Alan Wood's Pesticides |
| US5093347 | Patent |
| WO2011162397 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22546627 | Reaxys |
| CAS:1352994-67-2 | ChemIDplus |
| Citations |
|---|