EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N5O20P5 |
| Net Charge | 0 |
| Average Mass | 683.139 |
| Monoisotopic Mass | 682.92332 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](OP(=O)(O)OP(=O)(O)O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H18N5O20P5/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6(32-39(26,27)33-36(18,19)20)3(31-9)1-30-38(24,25)35-40(28,29)34-37(21,22)23/h2-3,5-6,9,16H,1H2,(H,24,25)(H,26,27)(H,28,29)(H2,18,19,20)(H2,21,22,23)(H3,11,13,14,17)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | KCPMACXZAITQAX-UUOKFMHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanosine 3'-diphosphate 5'-triphosphate (CHEBI:16690) has role Escherichia coli metabolite (CHEBI:76971) |
| guanosine 3'-diphosphate 5'-triphosphate (CHEBI:16690) has role mouse metabolite (CHEBI:75771) |
| guanosine 3'-diphosphate 5'-triphosphate (CHEBI:16690) is a guanosine 5'-phosphate (CHEBI:37121) |
| guanosine 3'-diphosphate 5'-triphosphate (CHEBI:16690) is a guanosine bisphosphate (CHEBI:37124) |
| guanosine 3'-diphosphate 5'-triphosphate (CHEBI:16690) is conjugate acid of guanosine 3'-diphosphate 5'-triphosphate hexaanion (CHEBI:142410) |
| Incoming Relation(s) |
| guanosine 3'-diphosphate 5'-triphosphate hexaanion (CHEBI:142410) is conjugate base of guanosine 3'-diphosphate 5'-triphosphate (CHEBI:16690) |
| IUPAC Name |
|---|
| guanosine 5'-(tetrahydrogen triphosphate) 3'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| Guanosine 3'-diphosphate 5'-triphosphate | KEGG COMPOUND |
| Guanosine 5'-triphosphate,3'-diphosphate | KEGG COMPOUND |
| Guanosine pentaphosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C04494 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1205996 | Beilstein |
| CAS:38918-96-6 | KEGG COMPOUND |
| CAS:38918-96-6 | ChemIDplus |