EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O |
| Net Charge | 0 |
| Average Mass | 412.702 |
| Monoisotopic Mass | 412.37052 |
| SMILES | [H][C@@]12CC=C3[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CC/C(=C/C)C(C)C)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h7,11,19-20,22-23,25-27,30H,8-10,12-18H2,1-6H3/b21-7-/t20-,22+,23+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | MCWVPSBQQXUCTB-OQTIOYDCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Avena strigosa (ncbitaxon:38783) | - | PubMed (20557911) | |
| Carthamus oxyacanthus (ncbitaxon:122010) | - | DOI (10.1007/s00217-019-03414-w) | |
| Carthamus tinctorius (ncbitaxon:4222) | - | DOI (10.1007/s00217-019-03414-w) | |
| Corylus avellana (ncbitaxon:13451) | - | PubMed (32549600) | |
| Lycium ruthenicum (ncbitaxon:112879) | - | PubMed (30178878) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Olea europaea (ncbitaxon:4146) | - | DOI (10.1007/s00217-020-03522-y) | |
| Panax quinquefolius (ncbitaxon:44588) | - | PubMed (11829639) | |
| Sesamum indicum (ncbitaxon:4182) | - | PubMed (31373097) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avenasterol (CHEBI:166888) has parent hydride 5α-stigmastane (CHEBI:20658) |
| avenasterol (CHEBI:166888) has role plant metabolite (CHEBI:76924) |
| avenasterol (CHEBI:166888) is a 3β-hydroxy steroid (CHEBI:36836) |
| avenasterol (CHEBI:166888) is a phytosterols (CHEBI:26125) |
| avenasterol (CHEBI:166888) is a stigmastane sterol (CHEBI:131703) |
| avenasterol (CHEBI:166888) is a Δ7-sterol (CHEBI:138130) |
| IUPAC Name |
|---|
| (24Z)-5α-stigmasta-7,24(28)-dien-3β-ol |
| Synonyms | Source |
|---|---|
| 24Z-ethylidene-cholest-7-en-3β-ol | LIPID MAPS |
| 24Z-ethylidenelathosterol | ChemIDplus |
| 7-dehydroavenasterol | KEGG COMPOUND |
| delta7-avenasterol | ChemIDplus |
| (Z)-24-ethylidene-5α-cholest-7-en-3β-ol | ChemIDplus |
| δ-7-avenasterol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4444703 | ChemSpider |
| Avenasterol | Wikipedia |
| C00007322 | KNApSAcK |
| C15782 | KEGG COMPOUND |
| CPD-4125 | MetaCyc |
| FDB030685 | FooDB |
| HMDB0006851 | HMDB |
| LMST01040154 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:23290-26-8 | ChemIDplus |
| Citations |
|---|