EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O2 |
| Net Charge | 0 |
| Average Mass | 190.202 |
| Monoisotopic Mass | 190.07423 |
| SMILES | CC(O)c1nc(=O)c2ccccc2n1 |
| InChI | InChI=1S/C10H10N2O2/c1-6(13)9-11-8-5-3-2-4-7(8)10(14)12-9/h2-6,13H,1H3,(H,11,12,14) |
| InChIKey | BMBSGGZMJQTQSO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium pseudograminearum CS3096 (ncbitaxon:1028729) | - | PubMed (28708398) | |
| Fusarium graminearum PH-1 (ncbitaxon:229533) | - | PubMed (28708398) | |
| Fusarium avenaceum (ncbitaxon:40199) | - | PubMed (25409087) | |
| Fusarium langsethiae (ncbitaxon:179993) | - | PubMed (26803271) | |
| Penicillium chrysogenum (ncbitaxon:5076) | - | PubMed (29196288) | |
| Aspergillus arachidicola (ncbitaxon:656916) | - | PubMed (18319485) | |
| Penicillium persicinum (ncbitaxon:268347) | - | PubMed (15280651) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysogine (CHEBI:166873) has role Aspergillus metabolite (CHEBI:76956) |
| chrysogine (CHEBI:166873) has role biological pigment (CHEBI:26130) |
| chrysogine (CHEBI:166873) has role marine metabolite (CHEBI:76507) |
| chrysogine (CHEBI:166873) is a cyclic amide (CHEBI:23443) |
| chrysogine (CHEBI:166873) is a quinazoline alkaloid (CHEBI:36470) |
| chrysogine (CHEBI:166873) is a quinazolines (CHEBI:38530) |
| chrysogine (CHEBI:166873) is a secondary alcohol (CHEBI:35681) |
| chrysogine (CHEBI:166873) is a secondary amide (CHEBI:33257) |
| IUPAC Name |
|---|
| 2-(1-hydroxyethyl)quinazolin-4(3H)-one |
| Synonyms | Source |
|---|---|
| 2-(1-hydroxyethyl)-3H-quinazolin-4-one | IUPAC |
| 2-(1-hydroxyethyl)-4(3H)-quinazolinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:42599-89-3 | ChemIDplus |
| Citations |
|---|