EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O2 |
| Net Charge | 0 |
| Average Mass | 190.202 |
| Monoisotopic Mass | 190.07423 |
| SMILES | CC(O)c1nc(=O)c2ccccc2n1 |
| InChI | InChI=1S/C10H10N2O2/c1-6(13)9-11-8-5-3-2-4-7(8)10(14)12-9/h2-6,13H,1H3,(H,11,12,14) |
| InChIKey | BMBSGGZMJQTQSO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus arachidicola (ncbitaxon:656916) | - | PubMed (18319485) | |
| Fusarium avenaceum (ncbitaxon:40199) | - | PubMed (25409087) | |
| Fusarium graminearum PH-1 (ncbitaxon:229533) | - | PubMed (28708398) | |
| Fusarium langsethiae (ncbitaxon:179993) | - | PubMed (26803271) | |
| Fusarium pseudograminearum CS3096 (ncbitaxon:1028729) | - | PubMed (28708398) | |
| Penicillium chrysogenum (ncbitaxon:5076) | - | PubMed (29196288) | |
| Penicillium persicinum (ncbitaxon:268347) | - | PubMed (15280651) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysogine (CHEBI:166873) has role Aspergillus metabolite (CHEBI:76956) |
| chrysogine (CHEBI:166873) has role biological pigment (CHEBI:26130) |
| chrysogine (CHEBI:166873) has role marine metabolite (CHEBI:76507) |
| chrysogine (CHEBI:166873) is a cyclic amide (CHEBI:23443) |
| chrysogine (CHEBI:166873) is a quinazoline alkaloid (CHEBI:36470) |
| chrysogine (CHEBI:166873) is a quinazolines (CHEBI:38530) |
| chrysogine (CHEBI:166873) is a secondary alcohol (CHEBI:35681) |
| chrysogine (CHEBI:166873) is a secondary amide (CHEBI:33257) |
| IUPAC Name |
|---|
| 2-(1-hydroxyethyl)quinazolin-4(3H)-one |
| Synonyms | Source |
|---|---|
| 2-(1-hydroxyethyl)-3H-quinazolin-4-one | IUPAC |
| 2-(1-hydroxyethyl)-4(3H)-quinazolinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:42599-89-3 | ChemIDplus |
| Citations |
|---|