EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13FN6O6S |
| Net Charge | 0 |
| Average Mass | 364.315 |
| Monoisotopic Mass | 364.06013 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@](F)(COS(N)(=O)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13FN6O6S/c11-10(1-22-24(13,20)21)6(19)5(18)9(23-10)17-3-16-4-7(12)14-2-15-8(4)17/h2-3,5-6,9,18-19H,1H2,(H2,12,14,15)(H2,13,20,21)/t5-,6+,9-,10-/m1/s1 |
| InChIKey | LTBCQBSAWAZBDF-MLTZYSBQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces asterosporus (ncbitaxon:285570) | - | PubMed (30641108) | Strain: DSM 41452 |
| Streptomyces calvus (ncbitaxon:67282) | |||
| - | PubMed (26374477) | Strain: ATCC 13382 | |
| - | PubMed (32110306) | Strain: T-3018 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nucleocidin (CHEBI:166872) has functional parent adenosine (CHEBI:16335) |
| nucleocidin (CHEBI:166872) has role antibacterial agent (CHEBI:33282) |
| nucleocidin (CHEBI:166872) has role bacterial metabolite (CHEBI:76969) |
| nucleocidin (CHEBI:166872) has role nucleoside antibiotic (CHEBI:25605) |
| nucleocidin (CHEBI:166872) has role protein synthesis inhibitor (CHEBI:48001) |
| nucleocidin (CHEBI:166872) has role trypanocidal drug (CHEBI:36335) |
| nucleocidin (CHEBI:166872) is a 6-aminopurines (CHEBI:20706) |
| nucleocidin (CHEBI:166872) is a adenosines (CHEBI:22260) |
| nucleocidin (CHEBI:166872) is a diol (CHEBI:23824) |
| nucleocidin (CHEBI:166872) is a organofluorine compound (CHEBI:37143) |
| nucleocidin (CHEBI:166872) is a sulfamate ester (CHEBI:48199) |
| IUPAC Name |
|---|
| [(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl sulfamate |
| Synonyms | Source |
|---|---|
| [(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-2-fluoro-3,4-dihydroxytetrahydrofuran-2-yl]methyl sulfamate | ChEBI |
| [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl sulfamate | ChEBI |
| 4'-C-fluoroadenosine 5'-sulfamate | ChemIDplus |
| 4'-fluoro-5'-O-sulfamoyladenosine | ChemIDplus |
| 4'-fluoro-5'-O-sulphamoyladenosine | MetaCyc |
| antibiotic T-3018 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 65250 | ChemSpider |
| CPD-12712 | MetaCyc |
| Nucleocidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:24751-69-7 | ChemIDplus |
| Citations |
|---|