EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6ClNO2 |
| Net Charge | 0 |
| Average Mass | 171.583 |
| Monoisotopic Mass | 171.00871 |
| SMILES | Nc1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C7H6ClNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | IFXKXCLVKQVVDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-5-chlorobenzoic acid (CHEBI:166853) is a aminobenzoic acid (CHEBI:22495) |
| 2-amino-5-chlorobenzoic acid (CHEBI:166853) is a chlorobenzoic acid (CHEBI:23134) |
| 2-amino-5-chlorobenzoic acid (CHEBI:166853) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-amino-5-chlorobenzoic acid |
| Synonyms | Source |
|---|---|
| 5-chloro-2-aminobenzoic acid | ChemIDplus |
| 5-chloroanthranilic acid | ChemIDplus |
| 2-carboxy-4-chloroaniline | ChEBI |
| Citations |
|---|