EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Cl2O2 |
| Net Charge | -1 |
| Average Mass | 190.005 |
| Monoisotopic Mass | 188.95156 |
| SMILES | O=C([O-])c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11)/p-1 |
| InChIKey | QAOJBHRZQQDFHA-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dichlorobenzoate (CHEBI:166851) is a chlorobenzoate (CHEBI:23133) |
| 2,3-dichlorobenzoate (CHEBI:166851) is conjugate base of 2,3-dichlorobenzoic acid (CHEBI:166845) |
| Incoming Relation(s) |
| 2,3-dichlorobenzoic acid (CHEBI:166845) is conjugate acid of 2,3-dichlorobenzoate (CHEBI:166851) |
| IUPAC Name |
|---|
| 2,3-dichlorobenzoate |
| Synonym | Source |
|---|---|
| 2,3-dichlorobenzoic acid anion | ChEBI |
| Citations |
|---|