EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:166846 - 3,5-dichlorobenzoic acid
| Formula | C7H4Cl2O2 |
| Net Charge | 0 |
| Average Mass | 191.013 |
| Monoisotopic Mass | 189.95883 |
| SMILES | O=C(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| InChIKey | CXKCZFDUOYMOOP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dichlorobenzoic acid (CHEBI:166846) has functional parent benzoic acid (CHEBI:30746) |
| 3,5-dichlorobenzoic acid (CHEBI:166846) has role herbicide (CHEBI:24527) |
| 3,5-dichlorobenzoic acid (CHEBI:166846) has role metabolite (CHEBI:25212) |
| 3,5-dichlorobenzoic acid (CHEBI:166846) is a chlorobenzoic acid (CHEBI:23134) |
| 3,5-dichlorobenzoic acid (CHEBI:166846) is a dichlorobenzene (CHEBI:23697) |
| 3,5-dichlorobenzoic acid (CHEBI:166846) is conjugate acid of 3,5-dichlorobenzoate (CHEBI:166847) |
| Incoming Relation(s) |
| 3,5-dichlorobenzoate (CHEBI:166847) is conjugate base of 3,5-dichlorobenzoic acid (CHEBI:166846) |
| IUPAC Name |
|---|
| 3,5-dichlorobenzoic acid |
| Synonyms | Source |
|---|---|
| benzoic acid, 3,5-dichloro- | ChemIDplus |
| 3,5-dichloro-benzoic acid | SUBMITTER |
| Citations |
|---|