EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O5 |
| Net Charge | 0 |
| Average Mass | 246.263 |
| Monoisotopic Mass | 246.12157 |
| SMILES | CC(C)C(NC(=O)CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N2O5/c1-5(2)8(10(16)17)12-7(13)4-3-6(11)9(14)15/h5-6,8H,3-4,11H2,1-2H3,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | AQAKHZVPOOGUCK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrobacter freundii (ncbitaxon:546) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2074) | |
| Enterobacter ludwigii (ncbitaxon:299767) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2074) | |
| Klebsiella oxytoca (ncbitaxon:571) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2074) | |
| Pseudomonas protegens (ncbitaxon:380021) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2074) | |
| Serratia plymuthica (ncbitaxon:82996) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2074) | |
| Sphingobacterium faecium (ncbitaxon:34087) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2074) | |
| Stenotrophomonas maltophilia (ncbitaxon:40324) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2074) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma-L-Glutamyl-L-valine (CHEBI:166843) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-amino-5-[(1-carboxy-2-methylpropyl)amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4476497 | ChemSpider |
| HMDB0011172 | HMDB |