EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23Cl2N3O4 |
| Net Charge | 0 |
| Average Mass | 428.316 |
| Monoisotopic Mass | 427.10656 |
| SMILES | CC(C)C[C@H](N[C@@H](Cc1cncn1Cc1cc(Cl)cc(Cl)c1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H23Cl2N3O4/c1-11(2)3-16(18(25)26)23-17(19(27)28)7-15-8-22-10-24(15)9-12-4-13(20)6-14(21)5-12/h4-6,8,10-11,16-17,23H,3,7,9H2,1-2H3,(H,25,26)(H,27,28)/t16-,17-/m0/s1 |
| InChIKey | NTCCRGGIJNDEAB-IRXDYDNUSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.17.23 (angiotensin-converting enzyme 2) inhibitor Any EC 3.4.17.* (metallocarboxypeptidase) inhibitor that inhibits the action of angiotensin-converting enzyme 2 (EC 3.4.17.23). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MLN-4760 (CHEBI:166834) has role anti-inflammatory agent (CHEBI:67079) |
| MLN-4760 (CHEBI:166834) has role EC 3.4.17.23 (angiotensin-converting enzyme 2) inhibitor (CHEBI:147289) |
| MLN-4760 (CHEBI:166834) is a L-histidine derivative (CHEBI:84076) |
| MLN-4760 (CHEBI:166834) is a L-leucine derivative (CHEBI:25018) |
| MLN-4760 (CHEBI:166834) is a dichlorobenzene (CHEBI:23697) |
| IUPAC Name |
|---|
| N-[(1S)-1-carboxy-3-methylbutyl]-3-(3,5-dichlorobenzyl)-L-histidine |
| Synonyms | Source |
|---|---|
| N-[(1S)-1-carboxy-3-methylbutyl]-3-[(3,5-dichlorophenyl)methyl]-L-histidine | IUPAC |
| (S,S)-2-(1-carboxy-2-(3-(3,5-dichlorobenzyl)-3H-imidazol-4-yl)-ethylamino)-4-methylpentanoic acid | PDBeChem |
| GL-1001 | ChemIDplus |
| GL1001 | DrugBank |
| MLN4760 | DrugBank |
| ORE-1001 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:305335-31-3 | ChemIDplus |
| Citations |
|---|