EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N7O5S3 |
| Net Charge | 0 |
| Average Mass | 497.584 |
| Monoisotopic Mass | 497.06098 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc2nsnc12)C(=O)O |
| InChI | InChI=1S/C17H19N7O5S3/c18-17(19)20-7-2-4-11(16(26)27)21-15(25)14-10(6-8-30-14)24-32(28,29)12-5-1-3-9-13(12)23-31-22-9/h1,3,5-6,8,11,24H,2,4,7H2,(H,21,25)(H,26,27)(H4,18,19,20)/t11-/m0/s1 |
| InChIKey | ZWWMEDURALZMEV-NSHDSACASA-N |
| Roles Classification |
|---|
| Biological Role: | neuropilin receptor antagonist An antagonist that binds to and deactivates neuropilin receptors. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EG00229 (CHEBI:166820) has role angiogenesis inhibitor (CHEBI:48422) |
| EG00229 (CHEBI:166820) has role antineoplastic agent (CHEBI:35610) |
| EG00229 (CHEBI:166820) has role neuropilin receptor antagonist (CHEBI:166909) |
| EG00229 (CHEBI:166820) is a L-arginine derivative (CHEBI:83965) |
| EG00229 (CHEBI:166820) is a benzothiadiazole (CHEBI:48864) |
| EG00229 (CHEBI:166820) is a dicarboxylic acid monoamide (CHEBI:35735) |
| EG00229 (CHEBI:166820) is a secondary carboxamide (CHEBI:140325) |
| EG00229 (CHEBI:166820) is a sulfonamide (CHEBI:35358) |
| EG00229 (CHEBI:166820) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N2-({3-[(2,1,3-benzothiadiazol-4-ylsulfonyl)amino]thiophen-2-yl}carbonyl)-L-arginine |
| Synonyms | Source |
|---|---|
| EG 00229 | ChEBI |
| EG-00229 | ChEBI |
| N2-[[3-[(2,1,3-benzothiadiazol-4-ylsulfonyl)amino]-2-thienyl]carbonyl]-L-arginine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8DR | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1018927-63-3 | ChEBI |
| Citations |
|---|