EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45NO |
| Net Charge | 0 |
| Average Mass | 399.663 |
| Monoisotopic Mass | 399.35012 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])C[C@]3([H])N5C[C@@H](C)CC[C@]5([H])[C@@H](C)[C@]43[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C27H45NO/c1-16-5-8-23-17(2)25-24(28(23)15-16)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h16-25,29H,5-15H2,1-4H3/t16-,17+,18-,19-,20+,21-,22-,23+,24-,25-,26-,27-/m0/s1 |
| InChIKey | JALVTHFTYRPDMB-HRRTYWNUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Demissidine (CHEBI:166814) is a alkaloid (CHEBI:22315) |
| Demissidine (CHEBI:166814) is a organic heteropolycyclic compound (CHEBI:38166) |
| Demissidine (CHEBI:166814) is a steroid (CHEBI:35341) |
| IUPAC Name |
|---|
| (1S,2R,5S,7S,10S,11S,14S,15R,16S,17R,20S,23S)-10,14,16,20-tetramethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracosan-7-ol |
| Manual Xrefs | Databases |
|---|---|
| 91607 | ChemSpider |
| LMST01150001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:474-08-8 | ChemIDplus |