EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O3 |
| Net Charge | 0 |
| Average Mass | 418.662 |
| Monoisotopic Mass | 418.34470 |
| SMILES | [H][C@]1([C@H](C)CC[C@H](O)C(C)C)CCC2C3CC(O)=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H46O3/c1-16(2)24(29)9-6-17(3)20-7-8-21-19-15-25(30)23-14-18(28)10-12-27(23,5)22(19)11-13-26(20,21)4/h16-22,24,28-30H,6-15H2,1-5H3/t17-,18+,19?,20-,21?,22?,24+,26-,27-/m1/s1 |
| InChIKey | WHTLPCXFTUAFRL-IAFIWARXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,24S-Dihydroxycholesterol (CHEBI:166809) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3S,10R,13R,17R)-17-[(2R,5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol |
| Manual Xrefs | Databases |
|---|---|
| 24823269 | ChemSpider |
| LMST01010132 | LIPID MAPS |