EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O2 |
| Net Charge | 0 |
| Average Mass | 400.647 |
| Monoisotopic Mass | 400.33413 |
| SMILES | [H][C@]1([C@H](C)CCC(=O)C(C)C)CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H44O2/c1-17(2)25(29)11-6-18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-24,28H,6,8-16H2,1-5H3/t18-,20+,21?,22-,23?,24?,26+,27-/m1/s1 |
| InChIKey | PGLNLCWHYQYRGQ-LBEZNTKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-Oxocholesterol (CHEBI:166803) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (6R)-6-[(3S,10R,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| 24823270 | ChemSpider |
| LMST01010133 | LIPID MAPS |